C37H36N4O7 — CID 6706065
2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6706065) has the molecular formula C37H36N4O7 and a molecular weight of 648.72 g/mol. Its IUPAC name is 2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6706065 |
| Molecular Formula | C37H36N4O7 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)O[C@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C37H36N4O7/c1-24-33(22-38-18-20-39(21-19-38)28-14-16-30(17-15-28)41(45)46)47-37(48-34(24)26-8-6-25(23-42)7-9-26)27-10-12-29(13-11-27)40-35(43)31-4-2-3-5-32(31)36(40)44/h2-17,24,33-34,37,42H,18-23H2,1H3/t24-,33+,34+,37+/m1/s1 |
| InChIKey | LZZQPGSVOUZTRF-LZPUOSEYSA-N |
| XLogP | 5.50 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|