C31H36N4O6 — CID 4138409
N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 4138409) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4138409 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2OC(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C(C)C(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C31H36N4O6/c1-21-29(19-33-15-17-34(18-16-33)27-11-13-28(14-12-27)35(38)39)40-31(25-7-9-26(10-8-25)32-22(2)37)41-30(21)24-5-3-23(20-36)4-6-24/h3-14,21,29-31,36H,15-20H2,1-2H3,(H,32,37) |
| InChIKey | SNUSZCRKNGTVMC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|