C37H41N5O6 — CID 6692230
1-benzyl-3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6692230) has the molecular formula C37H41N5O6 and a molecular weight of 651.76 g/mol. Its IUPAC name is 1-benzyl-3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6692230 |
| Molecular Formula | C37H41N5O6 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 1-benzyl-3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)NCc3ccccc3)c2)O[C@H]1CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C37H41N5O6/c1-26-34(24-40-18-20-41(21-19-40)32-14-16-33(17-15-32)42(45)46)47-36(48-35(26)29-12-10-28(25-43)11-13-29)30-8-5-9-31(22-30)39-37(44)38-23-27-6-3-2-4-7-27/h2-17,22,26,34-36,43H,18-21,23-25H2,1H3,(H2,38,39,44)/t26-,34+,35?,36+/m1/s1 |
| InChIKey | ZQJHCGSDGCUBAX-WDACWXDSSA-N |
| XLogP | 6.02 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|