C35H38N4O7S — CID 6686467
N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide (PubChem CID 6686467) has the molecular formula C35H38N4O7S and a molecular weight of 658.78 g/mol. Its IUPAC name is N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6686467 |
| Molecular Formula | C35H38N4O7S |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(NS(=O)(=O)c3ccccc3)c2)O[C@@H]1CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C35H38N4O7S/c1-25-33(23-37-18-20-38(21-19-37)30-14-16-31(17-15-30)39(41)42)45-35(46-34(25)27-12-10-26(24-40)11-13-27)28-6-5-7-29(22-28)36-47(43,44)32-8-3-2-4-9-32/h2-17,22,25,33-36,40H,18-21,23-24H2,1H3/t25-,33+,34?,35+/m0/s1 |
| InChIKey | OVRYNZDNLPWDLD-CQUOJPSFSA-N |
| XLogP | 5.50 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|