C45H53N3O4 — CID 6691792
1-(1-adamantyl)-3-[[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6691792) has the molecular formula C45H53N3O4 and a molecular weight of 699.94 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6691792 |
| Molecular Formula | C45H53N3O4 |
| Molecular Weight | 699.94 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | 1-(1-adamantyl)-3-[[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | C[C@@H]1[C@H](CN(Cc2ccccc2)Cc2ccccc2)O[C@H](c2ccc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C45H53N3O4/c1-31-41(29-48(27-33-8-4-2-5-9-33)28-34-10-6-3-7-11-34)51-43(52-42(31)39-16-14-35(30-49)15-17-39)40-18-12-32(13-19-40)26-46-44(50)47-45-23-36-20-37(24-45)22-38(21-36)25-45/h2-19,31,36-38,41-43,49H,20-30H2,1H3,(H2,46,47,50)/t31-,36?,37?,38?,41+,42+,43+,45?/m1/s1 |
| InChIKey | CBGVPFKCNAAIEV-AWFKTVDHSA-N |
| XLogP | 8.44 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.94 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |