C42H62N2O3 — CID 6687106
[4-[(2S,4R,5R,6S)-2-[4-[2-(aminomethyl)phenyl]phenyl]-6-[(dioctylamino)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6687106) has the molecular formula C42H62N2O3 and a molecular weight of 642.97 g/mol. Its IUPAC name is [4-[(2S,4R,5R,6S)-2-[4-[2-(aminomethyl)phenyl]phenyl]-6-[(dioctylamino)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,5R,6S)-2-[4-[2-(aminomethyl)phenyl]phenyl]-6-[(dioctylamino)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6687106 |
| Molecular Formula | C42H62N2O3 |
| Molecular Weight | 642.97 g/mol |
| Exact Mass | 642.48 |
| IUPAC Name | [4-[(2S,4R,5R,6S)-2-[4-[2-(aminomethyl)phenyl]phenyl]-6-[(dioctylamino)methyl]-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1O[C@@H](c2ccc(-c3ccccc3CN)cc2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C42H62N2O3/c1-4-6-8-10-12-16-28-44(29-17-13-11-9-7-5-2)31-40-33(3)41(36-22-20-34(32-45)21-23-36)47-42(46-40)37-26-24-35(25-27-37)39-19-15-14-18-38(39)30-43/h14-15,18-27,33,40-42,45H,4-13,16-17,28-32,43H2,1-3H3/t33-,40+,41?,42+/m0/s1 |
| InChIKey | UXTZGIGQWKVULL-UZUONHCLSA-N |
| XLogP | 10.12 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.97 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|