C41H60N2O5S — CID 6698317
N-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide (PubChem CID 6698317) has the molecular formula C41H60N2O5S and a molecular weight of 693.01 g/mol. Its IUPAC name is N-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6698317 |
| Molecular Formula | C41H60N2O5S |
| Molecular Weight | 693.01 g/mol |
| Exact Mass | 692.42 |
| IUPAC Name | N-[[4-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]benzenesulfonamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNS(=O)(=O)c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C41H60N2O5S/c1-3-5-7-9-11-16-28-43(29-17-12-10-8-6-4-2)32-38-30-40(36-24-22-35(33-44)23-25-36)48-41(47-38)37-26-20-34(21-27-37)31-42-49(45,46)39-18-14-13-15-19-39/h13-15,18-27,38,40-42,44H,3-12,16-17,28-33H2,1-2H3/t38-,40+,41+/m0/s1 |
| InChIKey | OQYBYGQFYFLPGQ-JOHBJDLISA-N |
| XLogP | 9.23 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.01 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|