C47H64N2O5S — CID 6703835
N-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide (PubChem CID 6703835) has the molecular formula C47H64N2O5S and a molecular weight of 769.11 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6703835 |
| Molecular Formula | C47H64N2O5S |
| Molecular Weight | 769.11 g/mol |
| Exact Mass | 768.45 |
| IUPAC Name | N-[[3-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3cccc(CNS(=O)(=O)c4ccccc4)c3)cc2)O1 |
| InChI | InChI=1S/C47H64N2O5S/c1-3-5-7-9-11-16-31-49(32-17-12-10-8-6-4-2)36-44-34-46(41-25-23-38(37-50)24-26-41)54-47(53-44)42-29-27-40(28-30-42)43-20-18-19-39(33-43)35-48-55(51,52)45-21-14-13-15-22-45/h13-15,18-30,33,44,46-48,50H,3-12,16-17,31-32,34-37H2,1-2H3/t44-,46+,47+/m1/s1 |
| InChIKey | RDXHPYQNESWBJB-TYWMPALESA-N |
| XLogP | 10.89 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.11 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|