C39H33F5N2O4 — CID 6708079
N-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6708079) has the molecular formula C39H33F5N2O4 and a molecular weight of 688.69 g/mol. Its IUPAC name is N-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6708079 |
| Molecular Formula | C39H33F5N2O4 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.24 |
| IUPAC Name | N-[4-[(2R,4R,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1ccc([C@H]2O[C@@H](CN(Cc3ccccc3)Cc3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C39H33F5N2O4/c40-33-32(34(41)36(43)37(44)35(33)42)38(48)45-29-17-15-28(16-18-29)39-49-30(19-31(50-39)27-13-11-26(23-47)12-14-27)22-46(20-24-7-3-1-4-8-24)21-25-9-5-2-6-10-25/h1-18,30-31,39,47H,19-23H2,(H,45,48)/t30-,31+,39+/m1/s1 |
| InChIKey | UEPJWQHNWRLIGQ-KJIWSKFMSA-N |
| XLogP | 8.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|