C32H44N2O6 — CID 3627890
7-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid (PubChem CID 3627890) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is 7-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid.
| Compound Name | 7-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 3627890 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 7-[3-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)Nc1cccc(C2OC(CN3CCCCCCC3)CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C32H44N2O6/c35-23-24-14-16-25(17-15-24)29-21-28(22-34-18-7-2-1-3-8-19-34)39-32(40-29)26-10-9-11-27(20-26)33-30(36)12-5-4-6-13-31(37)38/h9-11,14-17,20,28-29,32,35H,1-8,12-13,18-19,21-23H2,(H,33,36)(H,37,38) |
| InChIKey | VDAFSGRBHHYQQE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|