C35H44N4O6 — CID 6678450
N-[3-[(2S,4S,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide (PubChem CID 6678450) has the molecular formula C35H44N4O6 and a molecular weight of 616.76 g/mol. Its IUPAC name is N-[3-[(2S,4S,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[3-[(2S,4S,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 6678450 |
| Molecular Formula | C35H44N4O6 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | N-[3-[(2S,4S,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1cccc([C@@H]2O[C@H](CN3CCN(Cc4ccccc4)CC3)C[C@H](c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C35H44N4O6/c40-25-27-13-15-28(16-14-27)32-22-31(24-39-19-17-38(18-20-39)23-26-7-2-1-3-8-26)44-35(45-32)29-9-6-10-30(21-29)36-33(41)11-4-5-12-34(42)37-43/h1-3,6-10,13-16,21,31-32,35,40,43H,4-5,11-12,17-20,22-25H2,(H,36,41)(H,37,42)/t31-,32+,35+/m0/s1 |
| InChIKey | NLIQMPJCQXTYCM-GTXBZULCSA-N |
| XLogP | 4.55 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|