C34H40ClN3O7 — CID 4536860
N-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide (PubChem CID 4536860) has the molecular formula C34H40ClN3O7 and a molecular weight of 638.16 g/mol. Its IUPAC name is N-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide.
| Compound Name | N-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 4536860 |
| Molecular Formula | C34H40ClN3O7 |
| Molecular Weight | 638.16 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | N-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxypentanediamide |
| SMILES | O=C(CCCC(=O)Nc1cccc(C2OC(CN3CCC(O)(c4ccc(Cl)cc4)CC3)CC(c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C34H40ClN3O7/c35-27-13-11-26(12-14-27)34(42)15-17-38(18-16-34)21-29-20-30(24-9-7-23(22-39)8-10-24)45-33(44-29)25-3-1-4-28(19-25)36-31(40)5-2-6-32(41)37-43/h1,3-4,7-14,19,29-30,33,39,42-43H,2,5-6,15-18,20-22H2,(H,36,40)(H,37,41) |
| InChIKey | FNIKPMHQYZQZDQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.16 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|