C37H46ClN3O7 — CID 6679053
N-[[4-[(2S,4S,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide (PubChem CID 6679053) has the molecular formula C37H46ClN3O7 and a molecular weight of 680.24 g/mol. Its IUPAC name is N-[[4-[(2S,4S,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide.
| Compound Name | N-[[4-[(2S,4S,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 6679053 |
| Molecular Formula | C37H46ClN3O7 |
| Molecular Weight | 680.24 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | N-[[4-[(2S,4S,6R)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)NCc1ccc([C@@H]2O[C@H](CN3CCC(O)(c4ccc(Cl)cc4)CC3)C[C@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C37H46ClN3O7/c38-31-16-14-30(15-17-31)37(45)18-20-41(21-19-37)24-32-22-33(28-10-8-27(25-42)9-11-28)48-36(47-32)29-12-6-26(7-13-29)23-39-34(43)4-2-1-3-5-35(44)40-46/h6-17,32-33,36,42,45-46H,1-5,18-25H2,(H,39,43)(H,40,44)/t32-,33+,36+/m0/s1 |
| InChIKey | DDXWPEPKEWHIHU-XNPVHZECSA-N |
| XLogP | 5.43 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.24 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|