C41H46ClN3O7 — CID 4211337
N-[[3-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide (PubChem CID 4211337) has the molecular formula C41H46ClN3O7 and a molecular weight of 728.29 g/mol. Its IUPAC name is N-[[3-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide.
| Compound Name | N-[[3-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
|---|---|
| PubChem CID | 4211337 |
| Molecular Formula | C41H46ClN3O7 |
| Molecular Weight | 728.29 g/mol |
| Exact Mass | 727.30 |
| IUPAC Name | N-[[3-[3-[4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxypentanediamide |
| SMILES | O=C(CCCC(=O)NCc1cccc(-c2cccc(C3OC(CN4CCC(O)(c5ccc(Cl)cc5)CC4)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C41H46ClN3O7/c42-35-16-14-34(15-17-35)41(49)18-20-45(21-19-41)26-36-24-37(30-12-10-28(27-46)11-13-30)52-40(51-36)33-7-2-6-32(23-33)31-5-1-4-29(22-31)25-43-38(47)8-3-9-39(48)44-50/h1-2,4-7,10-17,22-23,36-37,40,46,49-50H,3,8-9,18-21,24-27H2,(H,43,47)(H,44,48) |
| InChIKey | VUKPKQUIKNUKMV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.29 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|