C37H48N4O5 — CID 5072656
6-acetamido-N-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 5072656) has the molecular formula C37H48N4O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is 6-acetamido-N-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 5072656 |
| Molecular Formula | C37H48N4O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 6-acetamido-N-[3-[4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1cccc(C2OC(CN3CCN(Cc4ccccc4)CC3)CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C37H48N4O5/c1-28(43)38-18-7-3-6-13-36(44)39-33-12-8-11-32(23-33)37-45-34(24-35(46-37)31-16-14-30(27-42)15-17-31)26-41-21-19-40(20-22-41)25-29-9-4-2-5-10-29/h2,4-5,8-12,14-17,23,34-35,37,42H,3,6-7,13,18-22,24-27H2,1H3,(H,38,43)(H,39,44) |
| InChIKey | YVAJVOFJJFPXHK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|