C39H44N6O7 — CID 6678952
N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6678952) has the molecular formula C39H44N6O7 and a molecular weight of 708.82 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6678952 |
| Molecular Formula | C39H44N6O7 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCC(=O)Nc1cccc([C@@H]2O[C@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C39H44N6O7/c40-34-7-1-2-8-35(34)42-38(48)10-4-9-37(47)41-30-6-3-5-29(23-30)39-51-33(24-36(52-39)28-13-11-27(26-46)12-14-28)25-43-19-21-44(22-20-43)31-15-17-32(18-16-31)45(49)50/h1-3,5-8,11-18,23,33,36,39,46H,4,9-10,19-22,24-26,40H2,(H,41,47)(H,42,48)/t33-,36+,39+/m0/s1 |
| InChIKey | PKSKBJRXMMIELK-QEZWGBTOSA-N |
| XLogP | 5.78 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|