C43H53N3O6 — CID 6701254
1-(1-adamantyl)-3-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6701254) has the molecular formula C43H53N3O6 and a molecular weight of 707.91 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6701254 |
| Molecular Formula | C43H53N3O6 |
| Molecular Weight | 707.91 g/mol |
| Exact Mass | 707.39 |
| IUPAC Name | 1-(1-adamantyl)-3-[[3-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(-c2cccc([C@H]3O[C@@H](CN4CCC5(CC4)OCCO5)C[C@@H](c4ccc(CO)cc4)O3)c2)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C43H53N3O6/c47-28-29-7-9-34(10-8-29)39-22-38(27-46-13-11-43(12-14-46)49-15-16-50-43)51-40(52-39)37-6-2-5-36(21-37)35-4-1-3-30(20-35)26-44-41(48)45-42-23-31-17-32(24-42)19-33(18-31)25-42/h1-10,20-21,31-33,38-40,47H,11-19,22-28H2,(H2,44,45,48)/t31?,32?,33?,38-,39+,40+,42?/m1/s1 |
| InChIKey | FXPSNSIEWASESC-XFZYEYRISA-N |
| XLogP | 7.00 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.91 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |