C29H26N4O5S — CID 6707519
2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6707519) has the molecular formula C29H26N4O5S and a molecular weight of 542.62 g/mol. Its IUPAC name is 2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6707519 |
| Molecular Formula | C29H26N4O5S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | Cn1cnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O1 |
| InChI | InChI=1S/C29H26N4O5S/c1-32-17-30-31-29(32)39-16-22-14-25(19-8-6-18(15-34)7-9-19)38-28(37-22)20-10-12-21(13-11-20)33-26(35)23-4-2-3-5-24(23)27(33)36/h2-13,17,22,25,28,34H,14-16H2,1H3/t22-,25+,28+/m1/s1 |
| InChIKey | GRHJQTPHZQWMOG-ATILKMQGSA-N |
| XLogP | 4.45 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|