C32H27NO5S — CID 6707415
2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6707415) has the molecular formula C32H27NO5S and a molecular weight of 537.64 g/mol. Its IUPAC name is 2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6707415 |
| Molecular Formula | C32H27NO5S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc([C@H]2O[C@@H](CSc3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C32H27NO5S/c34-19-21-10-12-22(13-11-21)29-18-25(20-39-26-6-2-1-3-7-26)37-32(38-29)23-14-16-24(17-15-23)33-30(35)27-8-4-5-9-28(27)31(33)36/h1-17,25,29,32,34H,18-20H2/t25-,29+,32+/m1/s1 |
| InChIKey | LHNLTNCZLCJHFH-ISXOHIFFSA-N |
| XLogP | 6.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|