C35H34N4O4S — CID 6694380
N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6694380) has the molecular formula C35H34N4O4S and a molecular weight of 606.75 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6694380 |
| Molecular Formula | C35H34N4O4S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | N-[[3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | Cn1cnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)c4ccccc4)c3)cc2)O1 |
| InChI | InChI=1S/C35H34N4O4S/c1-39-23-37-38-35(39)44-22-31-19-32(27-12-10-24(21-40)11-13-27)43-34(42-31)29-16-14-26(15-17-29)30-9-5-6-25(18-30)20-36-33(41)28-7-3-2-4-8-28/h2-18,23,31-32,34,40H,19-22H2,1H3,(H,36,41)/t31-,32+,34+/m0/s1 |
| InChIKey | RWERZATWRSMNCX-VOTWKOMSSA-N |
| XLogP | 6.24 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |