C37H34N6O4S — CID 6666831
N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6666831) has the molecular formula C37H34N6O4S and a molecular weight of 658.78 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6666831 |
| Molecular Formula | C37H34N6O4S |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | Cn1cnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)c4cnc5ccccc5n4)c3)c2)O1 |
| InChI | InChI=1S/C37H34N6O4S/c1-43-23-40-42-37(43)48-22-30-18-34(26-14-12-24(21-44)13-15-26)47-36(46-30)29-9-5-8-28(17-29)27-7-4-6-25(16-27)19-39-35(45)33-20-38-31-10-2-3-11-32(31)41-33/h2-17,20,23,30,34,36,44H,18-19,21-22H2,1H3,(H,39,45)/t30-,34+,36+/m1/s1 |
| InChIKey | YNYXUTOTHPSTTK-GXMSHJNRSA-N |
| XLogP | 6.19 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |