C27H32N4O6S — CID 6673142
5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6673142) has the molecular formula C27H32N4O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is 5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6673142 |
| Molecular Formula | C27H32N4O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | Cn1cnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C27H32N4O6S/c1-31-17-29-30-27(31)38-16-22-13-23(20-9-7-19(15-32)8-10-20)37-26(36-22)21-11-5-18(6-12-21)14-28-24(33)3-2-4-25(34)35/h5-12,17,22-23,26,32H,2-4,13-16H2,1H3,(H,28,33)(H,34,35)/t22-,23+,26+/m1/s1 |
| InChIKey | OTMADQOPEZPJFO-UMFSSWHCSA-N |
| XLogP | 3.52 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |