C32H35N5O6S — CID 6699846
methyl (2S)-2-[[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6699846) has the molecular formula C32H35N5O6S and a molecular weight of 617.73 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6699846 |
| Molecular Formula | C32H35N5O6S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | methyl (2S)-2-[[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1cccc([C@H]2O[C@@H](CSc3nncn3C)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C32H35N5O6S/c1-37-20-33-36-32(37)44-19-26-17-28(23-13-11-22(18-38)12-14-23)43-30(42-26)24-9-6-10-25(16-24)34-31(40)35-27(29(39)41-2)15-21-7-4-3-5-8-21/h3-14,16,20,26-28,30,38H,15,17-19H2,1-2H3,(H2,34,35,40)/t26-,27+,28+,30+/m1/s1 |
| InChIKey | BSQRDAWFXOQJBO-KGVZJERPSA-N |
| XLogP | 4.55 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |