C32H39N5O4S — CID 6706477
1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6706477) has the molecular formula C32H39N5O4S and a molecular weight of 589.76 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6706477 |
| Molecular Formula | C32H39N5O4S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | Cn1cnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O1 |
| InChI | InChI=1S/C32H39N5O4S/c1-37-19-33-36-31(37)42-18-27-13-28(24-4-2-20(17-38)3-5-24)41-29(40-27)25-6-8-26(9-7-25)34-30(39)35-32-14-21-10-22(15-32)12-23(11-21)16-32/h2-9,19,21-23,27-29,38H,10-18H2,1H3,(H2,34,35,39)/t21?,22?,23?,27-,28+,29+,32?/m0/s1 |
| InChIKey | QAKMODMXIOVJAS-YKQHWAHWSA-N |
| XLogP | 5.74 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |