C27H24Cl3N5O5S — CID 6707089
2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6707089) has the molecular formula C27H24Cl3N5O5S and a molecular weight of 636.95 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6707089 |
| Molecular Formula | C27H24Cl3N5O5S |
| Molecular Weight | 636.95 g/mol |
| Exact Mass | 635.06 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccc([C@@H]2O[C@H](CSc3nnnn3-c3ccc(O)cc3)C[C@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H24Cl3N5O5S/c28-27(29,30)25(38)31-19-7-5-18(6-8-19)24-39-22(13-23(40-24)17-3-1-16(14-36)2-4-17)15-41-26-32-33-34-35(26)20-9-11-21(37)12-10-20/h1-12,22-24,36-37H,13-15H2,(H,31,38)/t22-,23+,24+/m0/s1 |
| InChIKey | JPPYROADMQRPDZ-RBZQAINGSA-N |
| XLogP | 5.51 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.95 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|