C28H36N6O6S — CID 6673293
N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 6673293) has the molecular formula C28H36N6O6S and a molecular weight of 584.70 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6673293 |
| Molecular Formula | C28H36N6O6S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | N'-hydroxy-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | Cn1nnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C28H36N6O6S/c1-34-28(30-32-33-34)41-18-23-15-24(21-11-9-20(17-35)10-12-21)40-27(39-23)22-13-7-19(8-14-22)16-29-25(36)5-3-2-4-6-26(37)31-38/h7-14,23-24,27,35,38H,2-6,15-18H2,1H3,(H,29,36)(H,31,37)/t23-,24+,27+/m1/s1 |
| InChIKey | SDQPOIVYSMXZMM-DXBVXKBHSA-N |
| XLogP | 3.11 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|