C25H30N6O6S — CID 6676875
N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6676875) has the molecular formula C25H30N6O6S and a molecular weight of 542.62 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6676875 |
| Molecular Formula | C25H30N6O6S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N'-hydroxy-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | Cn1nnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C25H30N6O6S/c1-31-25(27-29-30-31)38-15-20-13-21(17-7-5-16(14-32)6-8-17)37-24(36-20)18-9-11-19(12-10-18)26-22(33)3-2-4-23(34)28-35/h5-12,20-21,24,32,35H,2-4,13-15H2,1H3,(H,26,33)(H,28,34)/t20-,21+,24+/m0/s1 |
| InChIKey | ZHSLGIYDPNCZKE-YZUZCNPQSA-N |
| XLogP | 2.65 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|