C38H49N3O6 — CID 6687810
6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6687810) has the molecular formula C38H49N3O6 and a molecular weight of 643.82 g/mol. Its IUPAC name is 6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6687810 |
| Molecular Formula | C38H49N3O6 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | 6-acetamido-N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN3CC[C@H](O)C3)O2)cc1 |
| InChI | InChI=1S/C38H49N3O6/c1-26-35(24-41-21-19-33(44)23-41)46-38(47-37(26)30-13-11-28(25-42)12-14-30)31-17-15-29(16-18-31)34-9-6-5-8-32(34)22-40-36(45)10-4-3-7-20-39-27(2)43/h5-6,8-9,11-18,26,33,35,37-38,42,44H,3-4,7,10,19-25H2,1-2H3,(H,39,43)(H,40,45)/t26-,33+,35+,37?,38+/m1/s1 |
| InChIKey | CHFGVGDPMRLZOV-HLJHLMNASA-N |
| XLogP | 5.02 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|