C38H46N4O5S — CID 6688591
6-acetamido-N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6688591) has the molecular formula C38H46N4O5S and a molecular weight of 670.88 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6688591 |
| Molecular Formula | C38H46N4O5S |
| Molecular Weight | 670.88 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 6-acetamido-N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2ccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CSc4nccn4C)O3)cc2)c1 |
| InChI | InChI=1S/C38H46N4O5S/c1-26-34(25-48-38-40-20-21-42(38)3)46-37(47-36(26)31-13-11-28(24-43)12-14-31)32-17-15-30(16-18-32)33-9-7-8-29(22-33)23-41-35(45)10-5-4-6-19-39-27(2)44/h7-9,11-18,20-22,26,34,36-37,43H,4-6,10,19,23-25H2,1-3H3,(H,39,44)(H,41,45)/t26-,34+,36?,37+/m1/s1 |
| InChIKey | MNRIFZCUPPPWIA-LTDPBTARSA-N |
| XLogP | 6.48 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.88 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|