C35H40N4O6S — CID 6688593
ethyl 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6688593) has the molecular formula C35H40N4O6S and a molecular weight of 644.79 g/mol. Its IUPAC name is ethyl 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6688593 |
| Molecular Formula | C35H40N4O6S |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | ethyl 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(-c2ccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CSc4nccn4C)O3)cc2)c1 |
| InChI | InChI=1S/C35H40N4O6S/c1-4-43-31(41)20-38-34(42)37-19-25-6-5-7-29(18-25)26-12-14-28(15-13-26)33-44-30(22-46-35-36-16-17-39(35)3)23(2)32(45-33)27-10-8-24(21-40)9-11-27/h5-18,23,30,32-33,40H,4,19-22H2,1-3H3,(H2,37,38,42)/t23-,30+,32?,33+/m1/s1 |
| InChIKey | TUJFPMDBURLIBN-HNPXWIJISA-N |
| XLogP | 5.53 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |