C38H49N3O5 — CID 5163803
6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 5163803) has the molecular formula C38H49N3O5 and a molecular weight of 627.83 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 5163803 |
| Molecular Formula | C38H49N3O5 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | 6-acetamido-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | C=CCN(C)CC1OC(c2ccc(-c3cccc(CNC(=O)CCCCCNC(C)=O)c3)cc2)OC(c2ccc(CO)cc2)C1C |
| InChI | InChI=1S/C38H49N3O5/c1-5-22-41(4)25-35-27(2)37(32-15-13-29(26-42)14-16-32)46-38(45-35)33-19-17-31(18-20-33)34-11-9-10-30(23-34)24-40-36(44)12-7-6-8-21-39-28(3)43/h5,9-11,13-20,23,27,35,37-38,42H,1,6-8,12,21-22,24-26H2,2-4H3,(H,39,43)(H,40,44) |
| InChIKey | SIYYAZYHJZGGQG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|