C35H42N2O6 — CID 6681582
5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6681582) has the molecular formula C35H42N2O6 and a molecular weight of 586.73 g/mol. Its IUPAC name is 5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6681582 |
| Molecular Formula | C35H42N2O6 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 5-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | C=CCN(C)C[C@H]1O[C@@H](c2ccc(-c3cccc(CNC(=O)CCCC(=O)O)c3)cc2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C35H42N2O6/c1-4-19-37(3)22-31-24(2)34(28-13-11-25(23-38)12-14-28)43-35(42-31)29-17-15-27(16-18-29)30-8-5-7-26(20-30)21-36-32(39)9-6-10-33(40)41/h4-5,7-8,11-18,20,24,31,34-35,38H,1,6,9-10,19,21-23H2,2-3H3,(H,36,39)(H,40,41)/t24-,31+,34?,35+/m0/s1 |
| InChIKey | YRQZZZDFSCKSSR-NAEOJYLZSA-N |
| XLogP | 5.63 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|