C28H36N2O6 — CID 6687302
4-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6687302) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is 4-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6687302 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 4-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | C=CCN(C)C[C@@H]1O[C@H](c2ccc(CNC(=O)CCC(=O)O)cc2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C28H36N2O6/c1-4-15-30(3)17-24-19(2)27(22-9-7-21(18-31)8-10-22)36-28(35-24)23-11-5-20(6-12-23)16-29-25(32)13-14-26(33)34/h4-12,19,24,27-28,31H,1,13-18H2,2-3H3,(H,29,32)(H,33,34)/t19-,24+,27?,28+/m1/s1 |
| InChIKey | MJYBAVHMFJNLJU-ADLSGFMQSA-N |
| XLogP | 3.57 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|