C34H35N3O6S — CID 6688404
4-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6688404) has the molecular formula C34H35N3O6S and a molecular weight of 613.74 g/mol. Its IUPAC name is 4-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6688404 |
| Molecular Formula | C34H35N3O6S |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 4-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)CCC(=O)O)c3)c2)O[C@H]1CSc1ncccn1 |
| InChI | InChI=1S/C34H35N3O6S/c1-22-29(21-44-34-35-15-4-16-36-34)42-33(43-32(22)25-11-9-23(20-38)10-12-25)28-8-3-7-27(18-28)26-6-2-5-24(17-26)19-37-30(39)13-14-31(40)41/h2-12,15-18,22,29,32-33,38H,13-14,19-21H2,1H3,(H,37,39)(H,40,41)/t22-,29+,32?,33+/m1/s1 |
| InChIKey | UMIBTWAFPVDRKQ-GTGIVWOFSA-N |
| XLogP | 5.70 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |