C31H35NO7S — CID 6684200
4-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6684200) has the molecular formula C31H35NO7S and a molecular weight of 565.69 g/mol. Its IUPAC name is 4-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6684200 |
| Molecular Formula | C31H35NO7S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 4-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | COc1ccccc1SC[C@H]1O[C@@H](c2ccc(CNC(=O)CCC(=O)O)cc2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C31H35NO7S/c1-20-26(19-40-27-6-4-3-5-25(27)37-2)38-31(39-30(20)23-11-9-22(18-33)10-12-23)24-13-7-21(8-14-24)17-32-28(34)15-16-29(35)36/h3-14,20,26,30-31,33H,15-19H2,1-2H3,(H,32,34)(H,35,36)/t20-,26+,30?,31+/m0/s1 |
| InChIKey | XLOLJMMEFWESIG-GBYPNKEUSA-N |
| XLogP | 5.25 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |