C36H38N2O6S — CID 6684733
2-[[(2S,4S,5R,6R)-2-[3-[3-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684733) has the molecular formula C36H38N2O6S and a molecular weight of 626.78 g/mol. Its IUPAC name is 2-[[(2S,4S,5R,6R)-2-[3-[3-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2S,4S,5R,6R)-2-[3-[3-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684733 |
| Molecular Formula | C36H38N2O6S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 2-[[(2S,4S,5R,6R)-2-[3-[3-[(ethylcarbamoylamino)methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CCNC(=O)NCc1cccc(-c2cccc([C@H]3OC(c4ccc(CO)cc4)[C@@H](C)[C@@H](CSc4ccccc4C(=O)O)O3)c2)c1 |
| InChI | InChI=1S/C36H38N2O6S/c1-3-37-36(42)38-20-25-8-6-9-27(18-25)28-10-7-11-29(19-28)35-43-31(22-45-32-13-5-4-12-30(32)34(40)41)23(2)33(44-35)26-16-14-24(21-39)15-17-26/h4-19,23,31,33,35,39H,3,20-22H2,1-2H3,(H,40,41)(H2,37,38,42)/t23-,31+,33?,35+/m0/s1 |
| InChIKey | MVHMDAOLRXHFDT-GEJSDIMMSA-N |
| XLogP | 6.95 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |