C33H26F5N5O4S — CID 4277563
2,3,4,5,6-pentafluoro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 4277563) has the molecular formula C33H26F5N5O4S and a molecular weight of 683.66 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4277563 |
| Molecular Formula | C33H26F5N5O4S |
| Molecular Weight | 683.66 g/mol |
| Exact Mass | 683.16 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | CC1C(CSc2nnnn2-c2ccccc2)OC(c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C33H26F5N5O4S/c1-17-23(16-48-33-40-41-42-43(33)22-8-3-2-4-9-22)46-32(47-30(17)19-12-10-18(15-44)11-13-19)20-6-5-7-21(14-20)39-31(45)24-25(34)27(36)29(38)28(37)26(24)35/h2-14,17,23,30,32,44H,15-16H2,1H3,(H,39,45) |
| InChIKey | LNMVLRPAOODROO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|