C28H24F5N5O4S — CID 6705419
2,3,4,5,6-pentafluoro-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6705419) has the molecular formula C28H24F5N5O4S and a molecular weight of 621.59 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6705419 |
| Molecular Formula | C28H24F5N5O4S |
| Molecular Weight | 621.59 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C[C@@H]1[C@H](CSc2nnnn2C)O[C@H](c2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C28H24F5N5O4S/c1-13-18(12-43-28-35-36-37-38(28)2)41-27(42-25(13)15-5-3-14(11-39)4-6-15)16-7-9-17(10-8-16)34-26(40)19-20(29)22(31)24(33)23(32)21(19)30/h3-10,13,18,25,27,39H,11-12H2,1-2H3,(H,34,40)/t13-,18+,25+,27+/m1/s1 |
| InChIKey | XSNVHHKIEOCFEK-VKJCMAQASA-N |
| XLogP | 5.23 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|