C30H26F5N3O4S — CID 4997751
2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 4997751) has the molecular formula C30H26F5N3O4S and a molecular weight of 619.61 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4997751 |
| Molecular Formula | C30H26F5N3O4S |
| Molecular Weight | 619.61 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | CC1C(CSc2nccn2C)OC(c2ccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C30H26F5N3O4S/c1-15-20(14-43-30-36-11-12-38(30)2)41-29(42-27(15)17-5-3-16(13-39)4-6-17)18-7-9-19(10-8-18)37-28(40)21-22(31)24(33)26(35)25(34)23(21)32/h3-12,15,20,27,29,39H,13-14H2,1-2H3,(H,37,40) |
| InChIKey | LWFPUDLMFXWUHF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|