C33H42N4O4 — CID 6685675
1-[3-[(2S,4S,5R,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea (PubChem CID 6685675) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 1-[3-[(2S,4S,5R,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[3-[(2S,4S,5R,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 6685675 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 1-[3-[(2S,4S,5R,6R)-4-[(4-benzylpiperazin-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN3CCN(Cc4ccccc4)CC3)O2)c1 |
| InChI | InChI=1S/C33H42N4O4/c1-3-34-33(39)35-29-11-7-10-28(20-29)32-40-30(24(2)31(41-32)27-14-12-26(23-38)13-15-27)22-37-18-16-36(17-19-37)21-25-8-5-4-6-9-25/h4-15,20,24,30-32,38H,3,16-19,21-23H2,1-2H3,(H2,34,35,39)/t24-,30+,31?,32+/m0/s1 |
| InChIKey | CKOMCVLHZURBCP-FTHPFZORSA-N |
| XLogP | 4.93 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |