C34H31NO5S — CID 6688107
2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6688107) has the molecular formula C34H31NO5S and a molecular weight of 565.69 g/mol. Its IUPAC name is 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6688107 |
| Molecular Formula | C34H31NO5S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CSc2ccccc2)O[C@H](c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C34H31NO5S/c1-22-30(21-41-27-7-3-2-4-8-27)39-34(40-31(22)25-15-13-24(20-36)14-16-25)26-17-11-23(12-18-26)19-35-32(37)28-9-5-6-10-29(28)33(35)38/h2-18,22,30-31,34,36H,19-21H2,1H3/t22-,30+,31+,34+/m1/s1 |
| InChIKey | OEDZBOQTJYSQBS-INFLTFPSSA-N |
| XLogP | 6.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|