C37H39N5O4S — CID 6688758
1-benzyl-3-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6688758) has the molecular formula C37H39N5O4S and a molecular weight of 649.82 g/mol. Its IUPAC name is 1-benzyl-3-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6688758 |
| Molecular Formula | C37H39N5O4S |
| Molecular Weight | 649.82 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 1-benzyl-3-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@@H]1[C@H](CSc2nncn2C)O[C@H](c2cccc(-c3cccc(CNC(=O)NCc4ccccc4)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C37H39N5O4S/c1-25-33(23-47-37-41-40-24-42(37)2)45-35(46-34(25)29-16-14-27(22-43)15-17-29)32-13-7-12-31(19-32)30-11-6-10-28(18-30)21-39-36(44)38-20-26-8-4-3-5-9-26/h3-19,24-25,33-35,43H,20-23H2,1-2H3,(H2,38,39,44)/t25-,33+,34+,35+/m1/s1 |
| InChIKey | QHJVIYMZGFTXDP-MHPIWYEESA-N |
| XLogP | 6.56 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.82 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |