C37H37NO7S — CID 6684809
4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(prop-2-enoxycarbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684809) has the molecular formula C37H37NO7S and a molecular weight of 639.77 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(prop-2-enoxycarbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(prop-2-enoxycarbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684809 |
| Molecular Formula | C37H37NO7S |
| Molecular Weight | 639.77 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[(prop-2-enoxycarbonylamino)methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C=CCOC(=O)NCc1ccccc1-c1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccc(C(=O)O)cc3)O2)cc1 |
| InChI | InChI=1S/C37H37NO7S/c1-3-20-43-37(42)38-21-30-6-4-5-7-32(30)26-12-14-29(15-13-26)36-44-33(23-46-31-18-16-28(17-19-31)35(40)41)24(2)34(45-36)27-10-8-25(22-39)9-11-27/h3-19,24,33-34,36,39H,1,20-23H2,2H3,(H,38,42)(H,40,41)/t24-,33+,34?,36+/m0/s1 |
| InChIKey | WRMHAXLEWCYRPC-LXMYWTTQSA-N |
| XLogP | 7.54 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.77 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|