C38H39NO8S — CID 6684812
4-[[(2S,4S,5R,6R)-2-[4-[2-[[[(2S)-2-acetyloxypropanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684812) has the molecular formula C38H39NO8S and a molecular weight of 669.80 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-2-[4-[2-[[[(2S)-2-acetyloxypropanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-2-[4-[2-[[[(2S)-2-acetyloxypropanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684812 |
| Molecular Formula | C38H39NO8S |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-2-[4-[2-[[[(2S)-2-acetyloxypropanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CC(=O)O[C@@H](C)C(=O)NCc1ccccc1-c1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccc(C(=O)O)cc3)O2)cc1 |
| InChI | InChI=1S/C38H39NO8S/c1-23-34(22-48-32-18-16-29(17-19-32)37(43)44)46-38(47-35(23)28-10-8-26(21-40)9-11-28)30-14-12-27(13-15-30)33-7-5-4-6-31(33)20-39-36(42)24(2)45-25(3)41/h4-19,23-24,34-35,38,40H,20-22H2,1-3H3,(H,39,42)(H,43,44)/t23-,24-,34+,35?,38+/m0/s1 |
| InChIKey | MZZKGVSJCGZBGE-BHOBTCEJSA-N |
| XLogP | 6.70 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |