C37H35N3O5S — CID 6683667
N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 6683667) has the molecular formula C37H35N3O5S and a molecular weight of 633.77 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6683667 |
| Molecular Formula | C37H35N3O5S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3ccccc3CNC(=O)c3cccnc3)cc2)O[C@@H]1CSc1cccc[n+]1[O-] |
| InChI | InChI=1S/C37H35N3O5S/c1-25-33(24-46-34-10-4-5-20-40(34)43)44-37(45-35(25)28-13-11-26(23-41)12-14-28)29-17-15-27(16-18-29)32-9-3-2-7-30(32)22-39-36(42)31-8-6-19-38-21-31/h2-21,25,33,35,37,41H,22-24H2,1H3,(H,39,42)/t25-,33+,35?,37+/m0/s1 |
| InChIKey | WYXXAGDVFPLKKK-GICVFNJTSA-N |
| XLogP | 6.39 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|