C39H35F5N2O4 — CID 6691639
2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6691639) has the molecular formula C39H35F5N2O4 and a molecular weight of 690.71 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6691639 |
| Molecular Formula | C39H35F5N2O4 |
| Molecular Weight | 690.71 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C[C@@H]1[C@H](CN(C)[C@H](C)c2ccc3ccccc3c2)O[C@H](c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C39H35F5N2O4/c1-21-30(19-46(3)22(2)26-16-15-24-7-4-5-8-27(24)17-26)49-39(50-37(21)25-13-11-23(20-47)12-14-25)28-9-6-10-29(18-28)45-38(48)31-32(40)34(42)36(44)35(43)33(31)41/h4-18,21-22,30,37,39,47H,19-20H2,1-3H3,(H,45,48)/t21-,22-,30+,37+,39+/m1/s1 |
| InChIKey | MLRKZNAQTUMAHK-VVUWCNPRSA-N |
| XLogP | 8.76 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.71 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|