C30H29F5N2O5 — CID 6681989
2,3,4,5,6-pentafluoro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6681989) has the molecular formula C30H29F5N2O5 and a molecular weight of 592.56 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6681989 |
| Molecular Formula | C30H29F5N2O5 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C[C@H]1[C@@H](CN2CC[C@H](O)C2)O[C@@H](c2cccc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C30H29F5N2O5/c1-15-21(13-37-10-9-20(39)12-37)41-30(42-28(15)17-7-5-16(14-38)6-8-17)18-3-2-4-19(11-18)36-29(40)22-23(31)25(33)27(35)26(34)24(22)32/h2-8,11,15,20-21,28,30,38-39H,9-10,12-14H2,1H3,(H,36,40)/t15-,20-,21+,28+,30+/m0/s1 |
| InChIKey | DWRYDMMBKBOVPF-WVPMSILBSA-N |
| XLogP | 4.98 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|