C36H31Cl3N2O5S — CID 6705085
2,2,2-trichloro-N-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6705085) has the molecular formula C36H31Cl3N2O5S and a molecular weight of 710.08 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6705085 |
| Molecular Formula | C36H31Cl3N2O5S |
| Molecular Weight | 710.08 g/mol |
| Exact Mass | 708.10 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)O[C@@H]1CSc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C36H31Cl3N2O5S/c1-22-29(21-47-35-41-30(24-8-4-2-5-9-24)32(46-35)25-10-6-3-7-11-25)44-33(45-31(22)26-14-12-23(20-42)13-15-26)27-16-18-28(19-17-27)40-34(43)36(37,38)39/h2-19,22,29,31,33,42H,20-21H2,1H3,(H,40,43)/t22-,29+,31?,33+/m0/s1 |
| InChIKey | QARJFFMXUREZSN-LZZRSWMHSA-N |
| XLogP | 9.39 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.08 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|