C41H42N4O6S — CID 3371023
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 3371023) has the molecular formula C41H42N4O6S and a molecular weight of 718.88 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 3371023 |
| Molecular Formula | C41H42N4O6S |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCC(=O)NCc1cccc(-c2ccc(C3OC(CSc4cccc[n+]4[O-])CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C41H42N4O6S/c42-35-9-1-2-10-36(35)44-39(48)12-6-11-38(47)43-25-29-7-5-8-33(23-29)30-18-20-32(21-19-30)41-50-34(27-52-40-13-3-4-22-45(40)49)24-37(51-41)31-16-14-28(26-46)15-17-31/h1-5,7-10,13-23,34,37,41,46H,6,11-12,24-27,42H2,(H,43,47)(H,44,48) |
| InChIKey | XOIRTYPOLJRZAW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|