C31H43N3O4 — CID 6695778
1-ethyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6695778) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is 1-ethyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6695778 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 1-ethyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | CCNC(=O)Nc1cccc([C@@H]2O[C@H](CN3CC4(C)CC3CC(C)(C)C4)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C31H43N3O4/c1-5-32-29(36)33-24-8-6-7-23(13-24)28-37-26(14-27(38-28)22-11-9-21(18-35)10-12-22)17-34-20-31(4)16-25(34)15-30(2,3)19-31/h6-13,25-28,35H,5,14-20H2,1-4H3,(H2,32,33,36)/t25?,26-,27+,28+,31?/m0/s1 |
| InChIKey | JLLRNRWNCSLDDX-LTNUXSACSA-N |
| XLogP | 5.77 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |